C15H29BrO2Si — CID 177454774
2-bromo-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol (PubChem CID 177454774) has the molecular formula C15H29BrO2Si and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-bromo-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol.
| Compound Name | 2-bromo-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 177454774 |
| Molecular Formula | C15H29BrO2Si |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-bromo-1-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-ol |
| SMILES | CC(C)(C)C1(O)CC(O[Si](C)(C)C(C)(C)C)C=C1Br |
| InChI | InChI=1S/C15H29BrO2Si/c1-13(2,3)15(17)10-11(9-12(15)16)18-19(7,8)14(4,5)6/h9,11,17H,10H2,1-8H3 |
| InChIKey | QUEOTOKLHVIZQH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|