About CID 177455904
CID 177455904 (PubChem CID 177455904) has the molecular formula C7H12GeN2
and a molecular weight of 196.80 g/mol.
Molecular Properties
| Compound Name | CID 177455904 |
| PubChem CID | 177455904 |
| Molecular Formula | C7H12GeN2 |
| Molecular Weight | 196.80 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | — |
| SMILES | C=C1C=C(C)N(C)[Ge]N1C |
| InChI | InChI=1S/C7H12GeN2/c1-6-5-7(2)10(4)8-9(6)3/h5H,1H2,2-4H3 |
| InChIKey | RNXLZHBVBXOKRB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.80 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 177455904 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177455904?
The IUPAC name of CID 177455904 (CID 177455904) is not available.
What is the SMILES notation for CID 177455904?
The canonical SMILES for CID 177455904 is C=C1C=C(C)N(C)[Ge]N1C.
What is the InChIKey of CID 177455904?
The InChIKey is RNXLZHBVBXOKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12GeN2/c1-6-5-7(2)10(4)8-9(6)3/h5H,1H2,2-4H3.
What are the key properties of CID 177455904?
CID 177455904 has a molecular weight of 196.80 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177455904 is sourced from PubChem (CID 177455904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).