C21H32O4 — CID 177456302
methyl (1S,2'S,3S,4S,7R)-7-[(Z)-hept-1-enyl]-2'-methoxy-2-oxospiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-1-carboxylate (PubChem CID 177456302) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl (1S,2'S,3S,4S,7R)-7-[(Z)-hept-1-enyl]-2'-methoxy-2-oxospiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-1-carboxylate.
| Compound Name | methyl (1S,2'S,3S,4S,7R)-7-[(Z)-hept-1-enyl]-2'-methoxy-2-oxospiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-1-carboxylate |
|---|---|
| PubChem CID | 177456302 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (1S,2'S,3S,4S,7R)-7-[(Z)-hept-1-enyl]-2'-methoxy-2-oxospiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-1-carboxylate |
| SMILES | CCCCC/C=C\[C@@H]1[C@@H]2CC[C@@]1(C(=O)OC)C(=O)[C@@]21CCC[C@@H]1OC |
| InChI | InChI=1S/C21H32O4/c1-4-5-6-7-8-10-15-16-12-14-21(15,19(23)25-3)18(22)20(16)13-9-11-17(20)24-2/h8,10,15-17H,4-7,9,11-14H2,1-3H3/b10-8-/t15-,16+,17+,20+,21+/m1/s1 |
| InChIKey | BOORVASVQGGBIS-ISWTXNTASA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|