About 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole
9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole (PubChem CID 177456755) has the molecular formula C15H13FS
and a molecular weight of 244.33 g/mol. Its IUPAC name is 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole.
Molecular Properties
| Compound Name | 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole |
| PubChem CID | 177456755 |
| Molecular Formula | C15H13FS |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole |
| SMILES | CC1(C)C=Cc2sc3ccccc3c2C=C1F |
| InChI | InChI=1S/C15H13FS/c1-15(2)8-7-13-11(9-14(15)16)10-5-3-4-6-12(10)17-13/h3-9H,1-2H3 |
| InChIKey | RGDIEPRBZWZTCP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole?
The IUPAC name of 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole (CID 177456755) is 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole.
What is the SMILES notation for 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole?
The canonical SMILES for 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole is CC1(C)C=Cc2sc3ccccc3c2C=C1F.
What is the InChIKey of 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole?
The InChIKey is RGDIEPRBZWZTCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FS/c1-15(2)8-7-13-11(9-14(15)16)10-5-3-4-6-12(10)17-13/h3-9H,1-2H3.
What are the key properties of 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole?
9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole has a molecular weight of 244.33 g/mol, XLogP of 5.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-8,8-dimethylcyclohepta[b][1]benzothiole is sourced from PubChem (CID 177456755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).