C36H64O4 — CID 177457113
(10Z,23E)-13,26-dihexyl-1,14-dioxacyclohexacosa-10,23-diene-2,15-dione (PubChem CID 177457113) has the molecular formula C36H64O4 and a molecular weight of 560.90 g/mol. Its IUPAC name is (10Z,23E)-13,26-dihexyl-1,14-dioxacyclohexacosa-10,23-diene-2,15-dione.
| Compound Name | (10Z,23E)-13,26-dihexyl-1,14-dioxacyclohexacosa-10,23-diene-2,15-dione |
|---|---|
| PubChem CID | 177457113 |
| Molecular Formula | C36H64O4 |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 560.48 |
| IUPAC Name | (10Z,23E)-13,26-dihexyl-1,14-dioxacyclohexacosa-10,23-diene-2,15-dione |
| SMILES | CCCCCCC1C/C=C\CCCCCCCC(=O)OC(CCCCCC)C/C=C/CCCCCCCC(=O)O1 |
| InChI | InChI=1S/C36H64O4/c1-3-5-7-21-27-33-29-23-17-13-9-11-16-20-26-32-36(38)40-34(28-22-8-6-4-2)30-24-18-14-10-12-15-19-25-31-35(37)39-33/h17-18,23-24,33-34H,3-16,19-22,25-32H2,1-2H3/b23-17-,24-18+ |
| InChIKey | AJOIUGLGUYENTE-QFFDILLMSA-N |
| XLogP | 11.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|