C19H33NO7 — CID 177458175
methyl (4R,4aS,8R,8aR)-8-[(decanoylamino)methyl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylate (PubChem CID 177458175) has the molecular formula C19H33NO7 and a molecular weight of 387.47 g/mol. Its IUPAC name is methyl (4R,4aS,8R,8aR)-8-[(decanoylamino)methyl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylate.
| Compound Name | methyl (4R,4aS,8R,8aR)-8-[(decanoylamino)methyl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylate |
|---|---|
| PubChem CID | 177458175 |
| Molecular Formula | C19H33NO7 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | methyl (4R,4aS,8R,8aR)-8-[(decanoylamino)methyl]-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4-carboxylate |
| SMILES | CCCCCCCCCC(=O)NC[C@H]1OCO[C@H]2[C@@H]1OCO[C@H]2C(=O)OC |
| InChI | InChI=1S/C19H33NO7/c1-3-4-5-6-7-8-9-10-15(21)20-11-14-16-17(26-12-24-14)18(19(22)23-2)27-13-25-16/h14,16-18H,3-13H2,1-2H3,(H,20,21)/t14-,16-,17+,18-/m1/s1 |
| InChIKey | NRUZXGOTWLNPEO-NRSFXHEJSA-N |
| XLogP | 1.90 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|