C20H42O6Si4 — CID 177458360
bis(trimethylsilyl) (3E,5E)-3,5-bis(trimethylsilyloxy)octa-3,5-dienedioate (PubChem CID 177458360) has the molecular formula C20H42O6Si4 and a molecular weight of 490.89 g/mol. Its IUPAC name is bis(trimethylsilyl) (3E,5E)-3,5-bis(trimethylsilyloxy)octa-3,5-dienedioate.
| Compound Name | bis(trimethylsilyl) (3E,5E)-3,5-bis(trimethylsilyloxy)octa-3,5-dienedioate |
|---|---|
| PubChem CID | 177458360 |
| Molecular Formula | C20H42O6Si4 |
| Molecular Weight | 490.89 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | bis(trimethylsilyl) (3E,5E)-3,5-bis(trimethylsilyloxy)octa-3,5-dienedioate |
| SMILES | C[Si](C)(C)OC(=O)C/C=C(\C=C(/CC(=O)O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H42O6Si4/c1-27(2,3)23-17(13-14-19(21)25-29(7,8)9)15-18(24-28(4,5)6)16-20(22)26-30(10,11)12/h13,15H,14,16H2,1-12H3/b17-13+,18-15+ |
| InChIKey | GFRGNHGRYPTLKR-YUIMGRLZSA-N |
| XLogP | 5.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.89 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|