C42H58N2P4 — CID 177458546
1,8-di(pentan-3-yl)-3,6,10,13-tetraphenyl-1,8-diaza-3,6,10,13-tetraphosphacyclotetradecane (PubChem CID 177458546) has the molecular formula C42H58N2P4 and a molecular weight of 714.84 g/mol. Its IUPAC name is 1,8-di(pentan-3-yl)-3,6,10,13-tetraphenyl-1,8-diaza-3,6,10,13-tetraphosphacyclotetradecane.
| Compound Name | 1,8-di(pentan-3-yl)-3,6,10,13-tetraphenyl-1,8-diaza-3,6,10,13-tetraphosphacyclotetradecane |
|---|---|
| PubChem CID | 177458546 |
| Molecular Formula | C42H58N2P4 |
| Molecular Weight | 714.84 g/mol |
| Exact Mass | 714.36 |
| IUPAC Name | 1,8-di(pentan-3-yl)-3,6,10,13-tetraphenyl-1,8-diaza-3,6,10,13-tetraphosphacyclotetradecane |
| SMILES | CCC(CC)N1CP(c2ccccc2)CCP(c2ccccc2)CN(C(CC)CC)CP(c2ccccc2)CCP(c2ccccc2)C1 |
| InChI | InChI=1S/C42H58N2P4/c1-5-37(6-2)43-33-45(39-21-13-9-14-22-39)29-31-47(41-25-17-11-18-26-41)35-44(38(7-3)8-4)36-48(42-27-19-12-20-28-42)32-30-46(34-43)40-23-15-10-16-24-40/h9-28,37-38H,5-8,29-36H2,1-4H3 |
| InChIKey | NRJNTLVYPSRLPI-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.84 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|