About 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene
1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene (PubChem CID 177459940) has the molecular formula C18H24
and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene.
Molecular Properties
| Compound Name | 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene |
| PubChem CID | 177459940 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene |
| SMILES | C#Cc1ccc(CC[C@@H](C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C18H24/c1-5-17-11-13-18(14-12-17)10-9-16(4)8-6-7-15(2)3/h1,7,11-14,16H,6,8-10H2,2-4H3/t16-/m0/s1 |
| InChIKey | GPZFLVZUCKJXHB-INIZCTEOSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene?
The IUPAC name of 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene (CID 177459940) is 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene.
What is the SMILES notation for 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene?
The canonical SMILES for 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene is C#Cc1ccc(CC[C@@H](C)CCC=C(C)C)cc1.
What is the InChIKey of 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene?
The InChIKey is GPZFLVZUCKJXHB-INIZCTEOSA-N. The full InChI is InChI=1S/C18H24/c1-5-17-11-13-18(14-12-17)10-9-16(4)8-6-7-15(2)3/h1,7,11-14,16H,6,8-10H2,2-4H3/t16-/m0/s1.
What are the key properties of 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene?
1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene has a molecular weight of 240.39 g/mol, XLogP of 4.98, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3,7-dimethyloct-6-enyl]-4-ethynylbenzene is sourced from PubChem (CID 177459940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).