C19H21N3O2 — CID 177459965
1,1,3,3-tetramethyl-2-(3-oxo-1-phenyl-2-benzofuran-1-yl)guanidine (PubChem CID 177459965) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(3-oxo-1-phenyl-2-benzofuran-1-yl)guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-(3-oxo-1-phenyl-2-benzofuran-1-yl)guanidine |
|---|---|
| PubChem CID | 177459965 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(3-oxo-1-phenyl-2-benzofuran-1-yl)guanidine |
| SMILES | CN(C)C(=NC1(c2ccccc2)OC(=O)c2ccccc21)N(C)C |
| InChI | InChI=1S/C19H21N3O2/c1-21(2)18(22(3)4)20-19(14-10-6-5-7-11-14)16-13-9-8-12-15(16)17(23)24-19/h5-13H,1-4H3 |
| InChIKey | XAXKRDVJTUGIHO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|