C16H28N3O2+ — CID 177460091
1-hydroxy-3-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole (PubChem CID 177460091) has the molecular formula C16H28N3O2+ and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-hydroxy-3-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole.
| Compound Name | 1-hydroxy-3-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
|---|---|
| PubChem CID | 177460091 |
| Molecular Formula | C16H28N3O2+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 1-hydroxy-3-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
| SMILES | ON1OC(N2CCC[N+]3=C2CCCCC3)C2CCCCC21 |
| InChI | InChI=1S/C16H28N3O2/c20-19-14-8-4-3-7-13(14)16(21-19)18-12-6-11-17-10-5-1-2-9-15(17)18/h13-14,16,20H,1-12H2/q+1 |
| InChIKey | ACALTQQXMGGYLL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|