C15H18O2 — CID 177461111
(4aS,8aS)-4a-ethenyl-8a-prop-2-ynyl-2,3,4,5,7,8-hexahydronaphthalene-1,6-dione (PubChem CID 177461111) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (4aS,8aS)-4a-ethenyl-8a-prop-2-ynyl-2,3,4,5,7,8-hexahydronaphthalene-1,6-dione.
| Compound Name | (4aS,8aS)-4a-ethenyl-8a-prop-2-ynyl-2,3,4,5,7,8-hexahydronaphthalene-1,6-dione |
|---|---|
| PubChem CID | 177461111 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (4aS,8aS)-4a-ethenyl-8a-prop-2-ynyl-2,3,4,5,7,8-hexahydronaphthalene-1,6-dione |
| SMILES | C#CC[C@@]12CCC(=O)C[C@]1(C=C)CCCC2=O |
| InChI | InChI=1S/C15H18O2/c1-3-8-15-10-7-12(16)11-14(15,4-2)9-5-6-13(15)17/h1,4H,2,5-11H2/t14-,15-/m0/s1 |
| InChIKey | WFGBYVVPTRBXSY-GJZGRUSLSA-N |
| XLogP | 2.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|