C32H50N10O2 — CID 177461601
5-[20-(5-hydroxypentyl)-4,12,16,24-tetramethyl-1,3,8,13,15,20,25,26,27,28-decazapentacyclo[20.2.1.13,6.110,13.115,18]octacosa-4,6(28),10(27),11,16,18(26),22(25),23-octaen-8-yl]pentan-1-ol (PubChem CID 177461601) has the molecular formula C32H50N10O2 and a molecular weight of 606.82 g/mol. Its IUPAC name is 5-[20-(5-hydroxypentyl)-4,12,16,24-tetramethyl-1,3,8,13,15,20,25,26,27,28-decazapentacyclo[20.2.1.13,6.110,13.115,18]octacosa-4,6(28),10(27),11,16,18(26),22(25),23-octaen-8-yl]pentan-1-ol.
| Compound Name | 5-[20-(5-hydroxypentyl)-4,12,16,24-tetramethyl-1,3,8,13,15,20,25,26,27,28-decazapentacyclo[20.2.1.13,6.110,13.115,18]octacosa-4,6(28),10(27),11,16,18(26),22(25),23-octaen-8-yl]pentan-1-ol |
|---|---|
| PubChem CID | 177461601 |
| Molecular Formula | C32H50N10O2 |
| Molecular Weight | 606.82 g/mol |
| Exact Mass | 606.41 |
| IUPAC Name | 5-[20-(5-hydroxypentyl)-4,12,16,24-tetramethyl-1,3,8,13,15,20,25,26,27,28-decazapentacyclo[20.2.1.13,6.110,13.115,18]octacosa-4,6(28),10(27),11,16,18(26),22(25),23-octaen-8-yl]pentan-1-ol |
| SMILES | Cc1cc2nn1Cn1nc(cc1C)CN(CCCCCO)Cc1cc(C)n(n1)Cn1nc(cc1C)CN(CCCCCO)C2 |
| InChI | InChI=1S/C32H50N10O2/c1-25-15-29-19-37(11-7-5-9-13-43)20-31-17-27(3)41(35-31)24-42-28(4)18-32(36-42)22-38(12-8-6-10-14-44)21-30-16-26(2)40(34-30)23-39(25)33-29/h15-18,43-44H,5-14,19-24H2,1-4H3 |
| InChIKey | JZVDKEFHEPWEAG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|