C22H41IO4Si — CID 177461735
(2R,3S,4R)-4-[(4R,5S,6R)-2,2-ditert-butyl-6-[(Z)-1-iodoprop-1-en-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]-3-methoxy-2-methylpentanal (PubChem CID 177461735) has the molecular formula C22H41IO4Si and a molecular weight of 524.56 g/mol. Its IUPAC name is (2R,3S,4R)-4-[(4R,5S,6R)-2,2-ditert-butyl-6-[(Z)-1-iodoprop-1-en-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]-3-methoxy-2-methylpentanal.
| Compound Name | (2R,3S,4R)-4-[(4R,5S,6R)-2,2-ditert-butyl-6-[(Z)-1-iodoprop-1-en-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]-3-methoxy-2-methylpentanal |
|---|---|
| PubChem CID | 177461735 |
| Molecular Formula | C22H41IO4Si |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | (2R,3S,4R)-4-[(4R,5S,6R)-2,2-ditert-butyl-6-[(Z)-1-iodoprop-1-en-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]-3-methoxy-2-methylpentanal |
| SMILES | CO[C@@H]([C@@H](C)[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@@H](/C(C)=C\I)[C@H]1C)[C@@H](C)C=O |
| InChI | InChI=1S/C22H41IO4Si/c1-14(12-23)19-17(4)20(16(3)18(25-11)15(2)13-24)27-28(26-19,21(5,6)7)22(8,9)10/h12-13,15-20H,1-11H3/b14-12-/t15-,16+,17+,18+,19-,20+/m0/s1 |
| InChIKey | KXIBPHREYLBTKN-BVISFMFPSA-N |
| XLogP | 6.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|