About ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate
ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate (PubChem CID 177462627) has the molecular formula C13H24O3Si
and a molecular weight of 256.42 g/mol. Its IUPAC name is ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate.
Molecular Properties
| Compound Name | ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate |
| PubChem CID | 177462627 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate |
| SMILES | C=CCCC/C(=C\C(=O)OCC)O[Si](C)(C)C |
| InChI | InChI=1S/C13H24O3Si/c1-6-8-9-10-12(16-17(3,4)5)11-13(14)15-7-2/h6,11H,1,7-10H2,2-5H3/b12-11+ |
| InChIKey | AMCYQRHJKKXAIX-VAWYXSNFSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate?
The IUPAC name of ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate (CID 177462627) is ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate.
What is the SMILES notation for ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate?
The canonical SMILES for ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate is C=CCCC/C(=C\C(=O)OCC)O[Si](C)(C)C.
What is the InChIKey of ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate?
The InChIKey is AMCYQRHJKKXAIX-VAWYXSNFSA-N. The full InChI is InChI=1S/C13H24O3Si/c1-6-8-9-10-12(16-17(3,4)5)11-13(14)15-7-2/h6,11H,1,7-10H2,2-5H3/b12-11+.
What are the key properties of ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate?
ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate has a molecular weight of 256.42 g/mol, XLogP of 3.64, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-3-trimethylsilyloxyocta-2,7-dienoate is sourced from PubChem (CID 177462627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).