C21H34O3Si — CID 177463388
(3aS,6E,10E,11aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one (PubChem CID 177463388) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is (3aS,6E,10E,11aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one.
| Compound Name | (3aS,6E,10E,11aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 177463388 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (3aS,6E,10E,11aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(/CO[Si](C)(C)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C21H34O3Si/c1-15-9-8-10-17(14-23-25(6,7)21(3,4)5)11-12-18-16(2)20(22)24-19(18)13-15/h10,13,18-19H,2,8-9,11-12,14H2,1,3-7H3/b15-13+,17-10+/t18-,19+/m0/s1 |
| InChIKey | MKJAYTCCBORWJV-MYISNJMYSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|