C28H41N5O10S — CID 177463413
(12S)-12-N-hydroxy-11-[(2-methylsulfonylphenyl)methyl]-8-N-(2-morpholin-4-yl-2-oxoethyl)-2,10-dioxo-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide (PubChem CID 177463413) has the molecular formula C28H41N5O10S and a molecular weight of 639.73 g/mol. Its IUPAC name is (12S)-12-N-hydroxy-11-[(2-methylsulfonylphenyl)methyl]-8-N-(2-morpholin-4-yl-2-oxoethyl)-2,10-dioxo-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide.
| Compound Name | (12S)-12-N-hydroxy-11-[(2-methylsulfonylphenyl)methyl]-8-N-(2-morpholin-4-yl-2-oxoethyl)-2,10-dioxo-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
|---|---|
| PubChem CID | 177463413 |
| Molecular Formula | C28H41N5O10S |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | (12S)-12-N-hydroxy-11-[(2-methylsulfonylphenyl)methyl]-8-N-(2-morpholin-4-yl-2-oxoethyl)-2,10-dioxo-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
| SMILES | CS(=O)(=O)c1ccccc1CC1C(=O)NC(C(=O)NCC(=O)N2CCOCC2)CCCCNC(=O)OCCC[C@@H]1C(=O)NO |
| InChI | InChI=1S/C28H41N5O10S/c1-44(40,41)23-10-3-2-7-19(23)17-21-20(26(36)32-39)8-6-14-43-28(38)29-11-5-4-9-22(31-25(21)35)27(37)30-18-24(34)33-12-15-42-16-13-33/h2-3,7,10,20-22,39H,4-6,8-9,11-18H2,1H3,(H,29,38)(H,30,37)(H,31,35)(H,32,36)/t20-,21?,22?/m0/s1 |
| InChIKey | COWWDHIPBGLZED-HWELCPFYSA-N |
| XLogP | -0.48 |
| TPSA | 209.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|