C42H48N2O6 — CID 177463511
37,38-dibutoxy-19,28-dioxa-22,25-diazahexacyclo[15.12.7.17,11.131,35.05,29.013,18]octatriaconta-1(29),2,4,7(38),8,10,13,15,17,31(37),32,34-dodecaene-21,26-dione (PubChem CID 177463511) has the molecular formula C42H48N2O6 and a molecular weight of 676.85 g/mol. Its IUPAC name is 37,38-dibutoxy-19,28-dioxa-22,25-diazahexacyclo[15.12.7.17,11.131,35.05,29.013,18]octatriaconta-1(29),2,4,7(38),8,10,13,15,17,31(37),32,34-dodecaene-21,26-dione.
| Compound Name | 37,38-dibutoxy-19,28-dioxa-22,25-diazahexacyclo[15.12.7.17,11.131,35.05,29.013,18]octatriaconta-1(29),2,4,7(38),8,10,13,15,17,31(37),32,34-dodecaene-21,26-dione |
|---|---|
| PubChem CID | 177463511 |
| Molecular Formula | C42H48N2O6 |
| Molecular Weight | 676.85 g/mol |
| Exact Mass | 676.35 |
| IUPAC Name | 37,38-dibutoxy-19,28-dioxa-22,25-diazahexacyclo[15.12.7.17,11.131,35.05,29.013,18]octatriaconta-1(29),2,4,7(38),8,10,13,15,17,31(37),32,34-dodecaene-21,26-dione |
| SMILES | CCCCOc1c2cccc1Cc1cccc3c1OCC(=O)NCCNC(=O)COc1c(cccc1Cc1cccc(c1OCCCC)C3)C2 |
| InChI | InChI=1S/C42H48N2O6/c1-3-5-21-47-39-29-11-7-12-30(39)24-34-16-10-18-36-26-32-14-8-13-31(40(32)48-22-6-4-2)25-35-17-9-15-33(23-29)41(35)49-27-37(45)43-19-20-44-38(46)28-50-42(34)36/h7-18H,3-6,19-28H2,1-2H3,(H,43,45)(H,44,46) |
| InChIKey | JKTNNKRYBUPPGU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.85 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|