About CID 177463521
CID 177463521 (PubChem CID 177463521) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol.
Molecular Properties
| Compound Name | CID 177463521 |
| PubChem CID | 177463521 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | — |
| SMILES | C[C]1n2c(=O)n(C)c(=O)n2[C](c2ccccc2)C1(C)C |
| InChI | InChI=1S/C15H17N3O2/c1-10-15(2,3)12(11-8-6-5-7-9-11)18-14(20)16(4)13(19)17(10)18/h5-9H,1-4H3 |
| InChIKey | JBCVRYPBQUFYCZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 177463521 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177463521?
The IUPAC name of CID 177463521 (CID 177463521) is not available.
What is the SMILES notation for CID 177463521?
The canonical SMILES for CID 177463521 is C[C]1n2c(=O)n(C)c(=O)n2[C](c2ccccc2)C1(C)C.
What is the InChIKey of CID 177463521?
The InChIKey is JBCVRYPBQUFYCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-10-15(2,3)12(11-8-6-5-7-9-11)18-14(20)16(4)13(19)17(10)18/h5-9H,1-4H3.
What are the key properties of CID 177463521?
CID 177463521 has a molecular weight of 271.32 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177463521 is sourced from PubChem (CID 177463521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).