C22H19NO — CID 177463569
(2E)-2-methyl-5,5-diphenyl-3-(1H-pyrrol-2-yl)penta-2,4-dienal (PubChem CID 177463569) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is (2E)-2-methyl-5,5-diphenyl-3-(1H-pyrrol-2-yl)penta-2,4-dienal.
| Compound Name | (2E)-2-methyl-5,5-diphenyl-3-(1H-pyrrol-2-yl)penta-2,4-dienal |
|---|---|
| PubChem CID | 177463569 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2E)-2-methyl-5,5-diphenyl-3-(1H-pyrrol-2-yl)penta-2,4-dienal |
| SMILES | C/C(C=O)=C(/C=C(c1ccccc1)c1ccccc1)c1ccc[nH]1 |
| InChI | InChI=1S/C22H19NO/c1-17(16-24)20(22-13-8-14-23-22)15-21(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-16,23H,1H3/b20-17+ |
| InChIKey | SMVFZTIVZUHYFQ-LVZFUZTISA-N |
| XLogP | 5.12 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|