C21H28N2O — CID 177464352
[(1R,9S,10S,12S,19S,20R)-8,20-dimethyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-trien-10-yl]methanol (PubChem CID 177464352) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is [(1R,9S,10S,12S,19S,20R)-8,20-dimethyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-trien-10-yl]methanol.
| Compound Name | [(1R,9S,10S,12S,19S,20R)-8,20-dimethyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-trien-10-yl]methanol |
|---|---|
| PubChem CID | 177464352 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | [(1R,9S,10S,12S,19S,20R)-8,20-dimethyl-8,16-diazahexacyclo[10.6.1.19,12.01,9.02,7.016,19]icosa-2,4,6-trien-10-yl]methanol |
| SMILES | C[C@@H]1[C@]23CCCN4CC[C@@]5(c6ccccc6N(C)[C@]15[C@@H](CO)C2)[C@@H]43 |
| InChI | InChI=1S/C21H28N2O/c1-14-19-8-5-10-23-11-9-20(18(19)23)16-6-3-4-7-17(16)22(2)21(14,20)15(12-19)13-24/h3-4,6-7,14-15,18,24H,5,8-13H2,1-2H3/t14-,15-,18+,19+,20-,21+/m1/s1 |
| InChIKey | AZRWVRBXCOXJLK-JZYIVEFVSA-N |
| XLogP | 2.63 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |