C11H18NO+ — CID 177465307
(4S,8aS)-4-prop-2-enyl-3,5,6,7,8,8a-hexahydro-1H-indolizin-4-ium-2-one (PubChem CID 177465307) has the molecular formula C11H18NO+ and a molecular weight of 180.27 g/mol. Its IUPAC name is (4S,8aS)-4-prop-2-enyl-3,5,6,7,8,8a-hexahydro-1H-indolizin-4-ium-2-one.
| Compound Name | (4S,8aS)-4-prop-2-enyl-3,5,6,7,8,8a-hexahydro-1H-indolizin-4-ium-2-one |
|---|---|
| PubChem CID | 177465307 |
| Molecular Formula | C11H18NO+ |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | (4S,8aS)-4-prop-2-enyl-3,5,6,7,8,8a-hexahydro-1H-indolizin-4-ium-2-one |
| SMILES | C=CC[N@+]12CCCC[C@H]1CC(=O)C2 |
| InChI | InChI=1S/C11H18NO/c1-2-6-12-7-4-3-5-10(12)8-11(13)9-12/h2,10H,1,3-9H2/q+1/t10-,12+/m0/s1 |
| InChIKey | LIOSQBYLDZATAB-CMPLNLGQSA-N |
| XLogP | 1.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|