C19H26O4 — CID 177467141
(3aS,4R,6Z,10E,11aS)-6,10-dimethyl-3-methylidene-4-(2-methylpropoxy)-4,8,9,11a-tetrahydro-3aH-cyclodeca[b]furan-2,5-dione (PubChem CID 177467141) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (3aS,4R,6Z,10E,11aS)-6,10-dimethyl-3-methylidene-4-(2-methylpropoxy)-4,8,9,11a-tetrahydro-3aH-cyclodeca[b]furan-2,5-dione.
| Compound Name | (3aS,4R,6Z,10E,11aS)-6,10-dimethyl-3-methylidene-4-(2-methylpropoxy)-4,8,9,11a-tetrahydro-3aH-cyclodeca[b]furan-2,5-dione |
|---|---|
| PubChem CID | 177467141 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3aS,4R,6Z,10E,11aS)-6,10-dimethyl-3-methylidene-4-(2-methylpropoxy)-4,8,9,11a-tetrahydro-3aH-cyclodeca[b]furan-2,5-dione |
| SMILES | C=C1C(=O)O[C@H]2/C=C(\C)CC/C=C(/C)C(=O)[C@H](OCC(C)C)[C@@H]12 |
| InChI | InChI=1S/C19H26O4/c1-11(2)10-22-18-16-14(5)19(21)23-15(16)9-12(3)7-6-8-13(4)17(18)20/h8-9,11,15-16,18H,5-7,10H2,1-4H3/b12-9+,13-8-/t15-,16-,18+/m0/s1 |
| InChIKey | SAOWIOVVJHKESK-BAPAZUQJSA-N |
| XLogP | 3.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|