C26H38ClN3O5 — CID 177467573
trans-(6S,9S)-3-[(2S)-butan-2-yl]-9-[(2-chlorophenyl)methyl]-6-methyl-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 177467573) has the molecular formula C26H38ClN3O5 and a molecular weight of 508.06 g/mol. Its IUPAC name is trans-(6S,9S)-3-[(2S)-butan-2-yl]-9-[(2-chlorophenyl)methyl]-6-methyl-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | trans-(6S,9S)-3-[(2S)-butan-2-yl]-9-[(2-chlorophenyl)methyl]-6-methyl-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 177467573 |
| Molecular Formula | C26H38ClN3O5 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | trans-(6S,9S)-3-[(2S)-butan-2-yl]-9-[(2-chlorophenyl)methyl]-6-methyl-13-pentyl-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCCCC1CC(=O)N[C@@H](Cc2ccccc2Cl)C(=O)N[C@@H](C)C(=O)NC([C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C26H38ClN3O5/c1-5-7-8-12-19-15-22(31)29-21(14-18-11-9-10-13-20(18)27)25(33)28-17(4)24(32)30-23(16(3)6-2)26(34)35-19/h9-11,13,16-17,19,21,23H,5-8,12,14-15H2,1-4H3,(H,28,33)(H,29,31)(H,30,32)/t16-,17-,19?,21-,23?/m0/s1 |
| InChIKey | GNPWAMUXJQHTJH-GTBCLSRKSA-N |
| XLogP | 3.30 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|