C24H32O6S — CID 177467731
dimethyl (2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-9-(2-methylprop-1-enyl)deca-2,6-dienedioate (PubChem CID 177467731) has the molecular formula C24H32O6S and a molecular weight of 448.58 g/mol. Its IUPAC name is dimethyl (2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-9-(2-methylprop-1-enyl)deca-2,6-dienedioate.
| Compound Name | dimethyl (2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-9-(2-methylprop-1-enyl)deca-2,6-dienedioate |
|---|---|
| PubChem CID | 177467731 |
| Molecular Formula | C24H32O6S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | dimethyl (2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-9-(2-methylprop-1-enyl)deca-2,6-dienedioate |
| SMILES | COC(=O)/C=C(\C)CC/C=C(\C)CC(C=C(C)C)(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H32O6S/c1-18(2)16-24(23(26)30-6,31(27,28)21-13-8-7-9-14-21)17-20(4)12-10-11-19(3)15-22(25)29-5/h7-9,12-16H,10-11,17H2,1-6H3/b19-15+,20-12+ |
| InChIKey | HWDMUKJZDZTPCE-UYCURAHMSA-N |
| XLogP | 4.57 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|