C11H19N3O3 — CID 177467948
(5S,6R,8R,9R,11R)-2-amino-5,8-dihydroxy-9,11-dimethyl-1,3-diazaspiro[5.5]undec-1-en-4-one (PubChem CID 177467948) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is (5S,6R,8R,9R,11R)-2-amino-5,8-dihydroxy-9,11-dimethyl-1,3-diazaspiro[5.5]undec-1-en-4-one.
| Compound Name | (5S,6R,8R,9R,11R)-2-amino-5,8-dihydroxy-9,11-dimethyl-1,3-diazaspiro[5.5]undec-1-en-4-one |
|---|---|
| PubChem CID | 177467948 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | (5S,6R,8R,9R,11R)-2-amino-5,8-dihydroxy-9,11-dimethyl-1,3-diazaspiro[5.5]undec-1-en-4-one |
| SMILES | C[C@@H]1C[C@@H](C)[C@@]2(C[C@H]1O)N=C(N)NC(=O)[C@H]2O |
| InChI | InChI=1S/C11H19N3O3/c1-5-3-6(2)11(4-7(5)15)8(16)9(17)13-10(12)14-11/h5-8,15-16H,3-4H2,1-2H3,(H3,12,13,14,17)/t5-,6-,7-,8-,11-/m1/s1 |
| InChIKey | WUNFGTJSXXMQLW-UYEZSENVSA-N |
| XLogP | -1.04 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |