C25H37NO4 — CID 177468114
(1R,2S,4R,5R,8R,9S,11R)-9-formyl-5-methyl-2-[(E)-[(2R)-2-methylbutoxy]iminomethyl]-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 177468114) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is (1R,2S,4R,5R,8R,9S,11R)-9-formyl-5-methyl-2-[(E)-[(2R)-2-methylbutoxy]iminomethyl]-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | (1R,2S,4R,5R,8R,9S,11R)-9-formyl-5-methyl-2-[(E)-[(2R)-2-methylbutoxy]iminomethyl]-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 177468114 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | (1R,2S,4R,5R,8R,9S,11R)-9-formyl-5-methyl-2-[(E)-[(2R)-2-methylbutoxy]iminomethyl]-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CC[C@@H](C)CO/N=C/[C@@]12C[C@@H]3[C@H](C)CC[C@H]3[C@@]3(C=O)C[C@@H]1C=C(C(C)C)[C@]32C(=O)O |
| InChI | InChI=1S/C25H37NO4/c1-6-16(4)12-30-26-13-23-11-19-17(5)7-8-20(19)24(14-27)10-18(23)9-21(15(2)3)25(23,24)22(28)29/h9,13-20H,6-8,10-12H2,1-5H3,(H,28,29)/b26-13+/t16-,17-,18+,19-,20-,23+,24+,25-/m1/s1 |
| InChIKey | JVCGORQOXXSIEI-DNKOCHBZSA-N |
| XLogP | 4.96 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|