C17H20N2O5 — CID 177468774
3-[5-[(Z)-(4-ethenyl-3-methyl-5-oxopyrrol-2-ylidene)methyl]-2-(hydroperoxymethyl)-4-methyl-1H-pyrrol-3-yl]propanoic acid (PubChem CID 177468774) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[5-[(Z)-(4-ethenyl-3-methyl-5-oxopyrrol-2-ylidene)methyl]-2-(hydroperoxymethyl)-4-methyl-1H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[5-[(Z)-(4-ethenyl-3-methyl-5-oxopyrrol-2-ylidene)methyl]-2-(hydroperoxymethyl)-4-methyl-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 177468774 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-[5-[(Z)-(4-ethenyl-3-methyl-5-oxopyrrol-2-ylidene)methyl]-2-(hydroperoxymethyl)-4-methyl-1H-pyrrol-3-yl]propanoic acid |
| SMILES | C=CC1=C(C)/C(=C/c2[nH]c(COO)c(CCC(=O)O)c2C)NC1=O |
| InChI | InChI=1S/C17H20N2O5/c1-4-11-9(2)14(19-17(11)22)7-13-10(3)12(5-6-16(20)21)15(18-13)8-24-23/h4,7,18,23H,1,5-6,8H2,2-3H3,(H,19,22)(H,20,21)/b14-7- |
| InChIKey | KIRZPQBODDMNRY-AUWJEWJLSA-N |
| XLogP | 2.30 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|