C13H19NO3 — CID 177470212
[(3S)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-yl] cyanate (PubChem CID 177470212) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is [(3S)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-yl] cyanate.
| Compound Name | [(3S)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-yl] cyanate |
|---|---|
| PubChem CID | 177470212 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | [(3S)-1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-yl] cyanate |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@H]1C=C[C@H](CC)OC#N |
| InChI | InChI=1S/C13H19NO3/c1-5-10(15-9-14)7-8-12-11(6-2)16-13(3,4)17-12/h6-8,10-12H,2,5H2,1,3-4H3/t10-,11-,12-/m0/s1 |
| InChIKey | RIFZJCQIQWVEJY-SRVKXCTJSA-N |
| XLogP | 2.52 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|