C13H15N5O2S — CID 177470253
3-[(E)-(2-hydroxyphenyl)methylideneamino]-4,6-dimethyl-2-sulfanylidene-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one (PubChem CID 177470253) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-[(E)-(2-hydroxyphenyl)methylideneamino]-4,6-dimethyl-2-sulfanylidene-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one.
| Compound Name | 3-[(E)-(2-hydroxyphenyl)methylideneamino]-4,6-dimethyl-2-sulfanylidene-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one |
|---|---|
| PubChem CID | 177470253 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-[(E)-(2-hydroxyphenyl)methylideneamino]-4,6-dimethyl-2-sulfanylidene-3a,6a-dihydro-1H-imidazo[4,5-d]imidazol-5-one |
| SMILES | CN1C(=O)N(C)C2C1NC(=S)N2/N=C/c1ccccc1O |
| InChI | InChI=1S/C13H15N5O2S/c1-16-10-11(17(2)13(16)20)18(12(21)15-10)14-7-8-5-3-4-6-9(8)19/h3-7,10-11,19H,1-2H3,(H,15,21)/b14-7+ |
| InChIKey | KRAAZJXLIKYDQH-VGOFMYFVSA-N |
| XLogP | 0.57 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|