C61H61N3O — CID 177470514
[2,6-bis[[2,6-bis(2,6-dimethylphenyl)phenyl]methyl]-4-tert-butylphenyl]imino-oxido-pyridin-4-ylazanium (PubChem CID 177470514) has the molecular formula C61H61N3O and a molecular weight of 852.18 g/mol. Its IUPAC name is [2,6-bis[[2,6-bis(2,6-dimethylphenyl)phenyl]methyl]-4-tert-butylphenyl]imino-oxido-pyridin-4-ylazanium.
| Compound Name | [2,6-bis[[2,6-bis(2,6-dimethylphenyl)phenyl]methyl]-4-tert-butylphenyl]imino-oxido-pyridin-4-ylazanium |
|---|---|
| PubChem CID | 177470514 |
| Molecular Formula | C61H61N3O |
| Molecular Weight | 852.18 g/mol |
| Exact Mass | 851.48 |
| IUPAC Name | [2,6-bis[[2,6-bis(2,6-dimethylphenyl)phenyl]methyl]-4-tert-butylphenyl]imino-oxido-pyridin-4-ylazanium |
| SMILES | Cc1cccc(C)c1-c1cccc(-c2c(C)cccc2C)c1Cc1cc(C(C)(C)C)cc(Cc2c(-c3c(C)cccc3C)cccc2-c2c(C)cccc2C)c1/N=[N+](\[O-])c1ccncc1 |
| InChI | InChI=1S/C61H61N3O/c1-38-18-12-19-39(2)56(38)50-26-16-27-51(57-40(3)20-13-21-41(57)4)54(50)36-46-34-48(61(9,10)11)35-47(60(46)63-64(65)49-30-32-62-33-31-49)37-55-52(58-42(5)22-14-23-43(58)6)28-17-29-53(55)59-44(7)24-15-25-45(59)8/h12-35H,36-37H2,1-11H3/b64-63- |
| InChIKey | DIHIVSFHYXQNDK-MJGXADGJSA-N |
| XLogP | 16.62 |
| TPSA | 51.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.18 |
| LogP ≤ 5 | 16.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|