C17H27N3O3 — CID 177470712
methyl 2-[[(1S)-2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]amino]-3-methylbutanoate (PubChem CID 177470712) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 2-[[(1S)-2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[(1S)-2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 177470712 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | methyl 2-[[(1S)-2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(N[C@H](C(=O)NC(C)(C)C)c1ccccn1)C(C)C |
| InChI | InChI=1S/C17H27N3O3/c1-11(2)13(16(22)23-6)19-14(12-9-7-8-10-18-12)15(21)20-17(3,4)5/h7-11,13-14,19H,1-6H3,(H,20,21)/t13?,14-/m0/s1 |
| InChIKey | HFHMFVBGWORTNW-KZUDCZAMSA-N |
| XLogP | 1.82 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |