C27H48O5SSi — CID 177470926
[(1S,3E,5R,7Z,11S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-5-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodeca-3,7-dien-5-yl]methyl methanesulfonate (PubChem CID 177470926) has the molecular formula C27H48O5SSi and a molecular weight of 512.83 g/mol. Its IUPAC name is [(1S,3E,5R,7Z,11S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-5-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodeca-3,7-dien-5-yl]methyl methanesulfonate.
| Compound Name | [(1S,3E,5R,7Z,11S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-5-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodeca-3,7-dien-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 177470926 |
| Molecular Formula | C27H48O5SSi |
| Molecular Weight | 512.83 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | [(1S,3E,5R,7Z,11S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-5-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodeca-3,7-dien-5-yl]methyl methanesulfonate |
| SMILES | CC(C)=CCC[C@]1(COS(C)(=O)=O)/C=C/C[C@]2(C)O[C@H]2CC/C(CO[Si](C)(C)C(C)(C)C)=C/C1 |
| InChI | InChI=1S/C27H48O5SSi/c1-22(2)12-10-17-27(21-30-33(7,28)29)18-11-16-26(6)24(32-26)14-13-23(15-19-27)20-31-34(8,9)25(3,4)5/h11-12,15,18,24H,10,13-14,16-17,19-21H2,1-9H3/b18-11+,23-15-/t24-,26-,27-/m0/s1 |
| InChIKey | OWEKMEOVKANVRL-KXIUZOBKSA-N |
| XLogP | 6.93 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.83 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|