C17H15Br2NO2 — CID 177471162
N-[1,2-bis(2-bromophenyl)-2-oxoethyl]-N-methylacetamide (PubChem CID 177471162) has the molecular formula C17H15Br2NO2 and a molecular weight of 425.12 g/mol. Its IUPAC name is N-[1,2-bis(2-bromophenyl)-2-oxoethyl]-N-methylacetamide.
| Compound Name | N-[1,2-bis(2-bromophenyl)-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 177471162 |
| Molecular Formula | C17H15Br2NO2 |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | N-[1,2-bis(2-bromophenyl)-2-oxoethyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)C(C(=O)c1ccccc1Br)c1ccccc1Br |
| InChI | InChI=1S/C17H15Br2NO2/c1-11(21)20(2)16(12-7-3-5-9-14(12)18)17(22)13-8-4-6-10-15(13)19/h3-10,16H,1-2H3 |
| InChIKey | IVTROWGUXOORPH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |