C16H29NO — CID 177471743
(E)-N,N-diethyl-7-methylideneundec-2-enamide (PubChem CID 177471743) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (E)-N,N-diethyl-7-methylideneundec-2-enamide.
| Compound Name | (E)-N,N-diethyl-7-methylideneundec-2-enamide |
|---|---|
| PubChem CID | 177471743 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (E)-N,N-diethyl-7-methylideneundec-2-enamide |
| SMILES | C=C(CCCC)CCC/C=C/C(=O)N(CC)CC |
| InChI | InChI=1S/C16H29NO/c1-5-8-12-15(4)13-10-9-11-14-16(18)17(6-2)7-3/h11,14H,4-10,12-13H2,1-3H3/b14-11+ |
| InChIKey | KLKRGTQQSLAZBD-SDNWHVSQSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|