C17H16N2O4 — CID 177471815
ethyl 3-methyl-2,5-dioxo-1-quinolin-8-ylpyrrolidine-3-carboxylate (PubChem CID 177471815) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 3-methyl-2,5-dioxo-1-quinolin-8-ylpyrrolidine-3-carboxylate.
| Compound Name | ethyl 3-methyl-2,5-dioxo-1-quinolin-8-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 177471815 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | ethyl 3-methyl-2,5-dioxo-1-quinolin-8-ylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(C)CC(=O)N(c2cccc3cccnc23)C1=O |
| InChI | InChI=1S/C17H16N2O4/c1-3-23-16(22)17(2)10-13(20)19(15(17)21)12-8-4-6-11-7-5-9-18-14(11)12/h4-9H,3,10H2,1-2H3 |
| InChIKey | WUHRTMQWKWIAIT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|