C9H13N3O3 — CID 177472638
1-[3-[(4E)-4-hydroxyimino-2,3-dihydropyrrol-5-yl]-4,5-dihydro-1,2-oxazol-5-yl]ethanol (PubChem CID 177472638) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-[3-[(4E)-4-hydroxyimino-2,3-dihydropyrrol-5-yl]-4,5-dihydro-1,2-oxazol-5-yl]ethanol.
| Compound Name | 1-[3-[(4E)-4-hydroxyimino-2,3-dihydropyrrol-5-yl]-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 177472638 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-[3-[(4E)-4-hydroxyimino-2,3-dihydropyrrol-5-yl]-4,5-dihydro-1,2-oxazol-5-yl]ethanol |
| SMILES | CC(O)C1CC(C2=NCC/C2=N\O)=NO1 |
| InChI | InChI=1S/C9H13N3O3/c1-5(13)8-4-7(12-15-8)9-6(11-14)2-3-10-9/h5,8,13-14H,2-4H2,1H3/b11-6+ |
| InChIKey | HKQOJRMJTVOUMA-IZZDOVSWSA-N |
| XLogP | 0.19 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|