C21H23NO3 — CID 177472898
[(1R,2S,3R,14R,15S)-5-methyl-13-oxo-12-azapentacyclo[13.2.1.02,14.03,12.06,11]octadeca-6,8,10,16-tetraen-5-yl]methyl acetate (PubChem CID 177472898) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is [(1R,2S,3R,14R,15S)-5-methyl-13-oxo-12-azapentacyclo[13.2.1.02,14.03,12.06,11]octadeca-6,8,10,16-tetraen-5-yl]methyl acetate.
| Compound Name | [(1R,2S,3R,14R,15S)-5-methyl-13-oxo-12-azapentacyclo[13.2.1.02,14.03,12.06,11]octadeca-6,8,10,16-tetraen-5-yl]methyl acetate |
|---|---|
| PubChem CID | 177472898 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [(1R,2S,3R,14R,15S)-5-methyl-13-oxo-12-azapentacyclo[13.2.1.02,14.03,12.06,11]octadeca-6,8,10,16-tetraen-5-yl]methyl acetate |
| SMILES | CC(=O)OCC1(C)C[C@@H]2[C@@H]3[C@H](C(=O)N2c2ccccc21)[C@@H]1C=C[C@H]3C1 |
| InChI | InChI=1S/C21H23NO3/c1-12(23)25-11-21(2)10-17-18-13-7-8-14(9-13)19(18)20(24)22(17)16-6-4-3-5-15(16)21/h3-8,13-14,17-19H,9-11H2,1-2H3/t13-,14+,17+,18+,19+,21?/m0/s1 |
| InChIKey | LZUZBAFMEMNPNK-BKBBONFBSA-N |
| XLogP | 3.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|