C14H24O3 — CID 177473156
(4aS,5R,8aR)-8a-butyl-4a,5-dihydroxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 177473156) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (4aS,5R,8aR)-8a-butyl-4a,5-dihydroxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,5R,8aR)-8a-butyl-4a,5-dihydroxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 177473156 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (4aS,5R,8aR)-8a-butyl-4a,5-dihydroxy-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | CCCC[C@@]12CCC[C@@H](O)[C@]1(O)CCCC2=O |
| InChI | InChI=1S/C14H24O3/c1-2-3-8-13-9-4-7-12(16)14(13,17)10-5-6-11(13)15/h12,16-17H,2-10H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | QKBLZIFQYYGYGX-HZSPNIEDSA-N |
| XLogP | 2.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |