C21H35NO2Si — CID 177473396
(1S,6S,7E)-5,5-dimethyl-2-oxo-7-[2-tri(propan-2-yl)silyloxyethylidene]bicyclo[4.1.0]heptane-1-carbonitrile (PubChem CID 177473396) has the molecular formula C21H35NO2Si and a molecular weight of 361.60 g/mol. Its IUPAC name is (1S,6S,7E)-5,5-dimethyl-2-oxo-7-[2-tri(propan-2-yl)silyloxyethylidene]bicyclo[4.1.0]heptane-1-carbonitrile.
| Compound Name | (1S,6S,7E)-5,5-dimethyl-2-oxo-7-[2-tri(propan-2-yl)silyloxyethylidene]bicyclo[4.1.0]heptane-1-carbonitrile |
|---|---|
| PubChem CID | 177473396 |
| Molecular Formula | C21H35NO2Si |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (1S,6S,7E)-5,5-dimethyl-2-oxo-7-[2-tri(propan-2-yl)silyloxyethylidene]bicyclo[4.1.0]heptane-1-carbonitrile |
| SMILES | CC(C)[Si](OC/C=C1\[C@@H]2C(C)(C)CCC(=O)[C@]12C#N)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H35NO2Si/c1-14(2)25(15(3)4,16(5)6)24-12-10-17-19-20(7,8)11-9-18(23)21(17,19)13-22/h10,14-16,19H,9,11-12H2,1-8H3/b17-10+/t19-,21+/m1/s1 |
| InChIKey | MOESAYNJOFMYIV-DFZTXGBGSA-N |
| XLogP | 5.63 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|