C24H34N6O9S — CID 177473432
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 177473432) has the molecular formula C24H34N6O9S and a molecular weight of 582.64 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 177473432 |
| Molecular Formula | C24H34N6O9S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[(7-nitro-2,1,3-benzoxadiazol-4-yl)oxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)NCCOCCOCCOCCOc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C24H34N6O9S/c31-20(4-2-1-3-19-21-16(15-40-19)26-24(32)27-21)25-7-8-35-9-10-36-11-12-37-13-14-38-18-6-5-17(30(33)34)22-23(18)29-39-28-22/h5-6,16,19,21H,1-4,7-15H2,(H,25,31)(H2,26,27,32)/t16-,19-,21-/m0/s1 |
| InChIKey | AOWPAWMVMOESTL-LRQRDZAKSA-N |
| XLogP | 1.40 |
| TPSA | 189.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|