C26H27N3O5 — CID 177473785
5-[(2Z,4E)-5-[ethyl-[(4-phenyldiazenylphenyl)methyl]amino]-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 177473785) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 5-[(2Z,4E)-5-[ethyl-[(4-phenyldiazenylphenyl)methyl]amino]-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2Z,4E)-5-[ethyl-[(4-phenyldiazenylphenyl)methyl]amino]-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 177473785 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 5-[(2Z,4E)-5-[ethyl-[(4-phenyldiazenylphenyl)methyl]amino]-2-hydroxypenta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCN(/C=C/C=C(\O)C=C1C(=O)OC(C)(C)OC1=O)Cc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N3O5/c1-4-29(16-8-11-22(30)17-23-24(31)33-26(2,3)34-25(23)32)18-19-12-14-21(15-13-19)28-27-20-9-6-5-7-10-20/h5-17,30H,4,18H2,1-3H3/b16-8+,22-11-,28-27+ |
| InChIKey | BRLUGMWEDMXVGH-IQIPZHPFSA-N |
| XLogP | 5.64 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|