C21H22N2O7S — CID 177473864
ethyl (2S,3R)-2-methyl-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxylate (PubChem CID 177473864) has the molecular formula C21H22N2O7S and a molecular weight of 446.48 g/mol. Its IUPAC name is ethyl (2S,3R)-2-methyl-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3R)-2-methyl-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 177473864 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | ethyl (2S,3R)-2-methyl-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)[C@@H](c2ccc([N+](=O)[O-])cc2)CC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22N2O7S/c1-4-30-20(25)21(3)18(15-7-9-16(10-8-15)23(26)27)13-19(24)22(21)31(28,29)17-11-5-14(2)6-12-17/h5-12,18H,4,13H2,1-3H3/t18-,21+/m1/s1 |
| InChIKey | JXYOHUDHPDSLLF-NQIIRXRSSA-N |
| XLogP | 2.93 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|