C20H14N2O5 — CID 177473990
10,16-dimethoxy-3-phenyl-8,12-dioxa-3,4-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),4,9,11(15),13-hexaen-7-one (PubChem CID 177473990) has the molecular formula C20H14N2O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is 10,16-dimethoxy-3-phenyl-8,12-dioxa-3,4-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),4,9,11(15),13-hexaen-7-one.
| Compound Name | 10,16-dimethoxy-3-phenyl-8,12-dioxa-3,4-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),4,9,11(15),13-hexaen-7-one |
|---|---|
| PubChem CID | 177473990 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 10,16-dimethoxy-3-phenyl-8,12-dioxa-3,4-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),4,9,11(15),13-hexaen-7-one |
| SMILES | COc1c2occc2c(OC)c2c1oc(=O)c1cnn(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H14N2O5/c1-24-16-12-8-9-26-17(12)19(25-2)18-14(16)15-13(20(23)27-18)10-21-22(15)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | DINSBFKRTGALNC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|