C17H26O7 — CID 177473991
ethyl (9S,10S,11R)-3,3,9-trimethyl-1,5-dioxo-11-propan-2-yl-2,4,7-trioxaspiro[5.5]undecane-10-carboxylate (PubChem CID 177473991) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is ethyl (9S,10S,11R)-3,3,9-trimethyl-1,5-dioxo-11-propan-2-yl-2,4,7-trioxaspiro[5.5]undecane-10-carboxylate.
| Compound Name | ethyl (9S,10S,11R)-3,3,9-trimethyl-1,5-dioxo-11-propan-2-yl-2,4,7-trioxaspiro[5.5]undecane-10-carboxylate |
|---|---|
| PubChem CID | 177473991 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | ethyl (9S,10S,11R)-3,3,9-trimethyl-1,5-dioxo-11-propan-2-yl-2,4,7-trioxaspiro[5.5]undecane-10-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](C)COC2(C(=O)OC(C)(C)OC2=O)[C@@H]1C(C)C |
| InChI | InChI=1S/C17H26O7/c1-7-21-13(18)11-10(4)8-22-17(12(11)9(2)3)14(19)23-16(5,6)24-15(17)20/h9-12H,7-8H2,1-6H3/t10-,11+,12-/m1/s1 |
| InChIKey | IQXIKMPVMKKTLE-GRYCIOLGSA-N |
| XLogP | 1.68 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|