About 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one
1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one (PubChem CID 177474479) has the molecular formula C15H13BrO2S
and a molecular weight of 337.24 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one.
Molecular Properties
| Compound Name | 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
| PubChem CID | 177474479 |
| Molecular Formula | C15H13BrO2S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
| SMILES | O=C1C2CCC1C1(Sc3ccccc3Br)C=CC2O1 |
| InChI | InChI=1S/C15H13BrO2S/c16-11-3-1-2-4-13(11)19-15-8-7-12(18-15)9-5-6-10(15)14(9)17/h1-4,7-10,12H,5-6H2 |
| InChIKey | YPQMTZXLWXHSJS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one?
The IUPAC name of 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one (CID 177474479) is 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one.
What is the SMILES notation for 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one?
The canonical SMILES for 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one is O=C1C2CCC1C1(Sc3ccccc3Br)C=CC2O1.
What is the InChIKey of 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one?
The InChIKey is YPQMTZXLWXHSJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrO2S/c16-11-3-1-2-4-13(11)19-15-8-7-12(18-15)9-5-6-10(15)14(9)17/h1-4,7-10,12H,5-6H2.
What are the key properties of 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one?
1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one has a molecular weight of 337.24 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromophenyl)sulfanyl-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one is sourced from PubChem (CID 177474479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).