About CID 177474620
CID 177474620 (PubChem CID 177474620) has the molecular formula C42H24Cl4F2N
and a molecular weight of 722.47 g/mol.
Molecular Properties
| Compound Name | CID 177474620 |
| PubChem CID | 177474620 |
| Molecular Formula | C42H24Cl4F2N |
| Molecular Weight | 722.47 g/mol |
| Exact Mass | 720.06 |
| IUPAC Name | — |
| SMILES | Fc1cncc(F)c1[C](c1c(Cl)cc(-c2ccccc2)c(-c2ccccc2)c1Cl)c1c(Cl)cc(-c2ccccc2)c(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C42H24Cl4F2N/c43-31-21-29(25-13-5-1-6-14-25)35(27-17-9-3-10-18-27)41(45)37(31)40(39-33(47)23-49-24-34(39)48)38-32(44)22-30(26-15-7-2-8-16-26)36(42(38)46)28-19-11-4-12-20-28/h1-24H |
| InChIKey | IBBZVCXCRQVRKV-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 722.47 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 177474620 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177474620?
The IUPAC name of CID 177474620 (CID 177474620) is not available.
What is the SMILES notation for CID 177474620?
The canonical SMILES for CID 177474620 is Fc1cncc(F)c1[C](c1c(Cl)cc(-c2ccccc2)c(-c2ccccc2)c1Cl)c1c(Cl)cc(-c2ccccc2)c(-c2ccccc2)c1Cl.
What is the InChIKey of CID 177474620?
The InChIKey is IBBZVCXCRQVRKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H24Cl4F2N/c43-31-21-29(25-13-5-1-6-14-25)35(27-17-9-3-10-18-27)41(45)37(31)40(39-33(47)23-49-24-34(39)48)38-32(44)22-30(26-15-7-2-8-16-26)36(42(38)46)28-19-11-4-12-20-28/h1-24H.
What are the key properties of CID 177474620?
CID 177474620 has a molecular weight of 722.47 g/mol, XLogP of 13.66, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177474620 is sourced from PubChem (CID 177474620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).