C56H64NO10P — CID 177476202
[(2R)-2,3-bis[6-[4-(4-phenylphenyl)phenoxy]hexanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 177476202) has the molecular formula C56H64NO10P and a molecular weight of 942.10 g/mol. Its IUPAC name is [(2R)-2,3-bis[6-[4-(4-phenylphenyl)phenoxy]hexanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2,3-bis[6-[4-(4-phenylphenyl)phenoxy]hexanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 177476202 |
| Molecular Formula | C56H64NO10P |
| Molecular Weight | 942.10 g/mol |
| Exact Mass | 941.43 |
| IUPAC Name | [(2R)-2,3-bis[6-[4-(4-phenylphenyl)phenoxy]hexanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC[C@@H](COC(=O)CCCCCOc1ccc(-c2ccc(-c3ccccc3)cc2)cc1)OC(=O)CCCCCOc1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C56H64NO10P/c1-57(2,3)38-41-65-68(60,61)66-43-54(67-56(59)21-13-7-15-40-63-53-36-32-51(33-37-53)49-28-24-47(25-29-49)45-18-10-5-11-19-45)42-64-55(58)20-12-6-14-39-62-52-34-30-50(31-35-52)48-26-22-46(23-27-48)44-16-8-4-9-17-44/h4-5,8-11,16-19,22-37,54H,6-7,12-15,20-21,38-43H2,1-3H3/t54-/m1/s1 |
| InChIKey | YCCXDIMKZIITCC-AXAMJWTMSA-N |
| XLogP | 11.60 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.10 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|