C20H33NO2 — CID 177476326
4-[(1E,3E)-3-(cyclohexen-1-yl)-2-(ethoxymethyl)-5-methylhexa-1,3-dienyl]morpholine (PubChem CID 177476326) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 4-[(1E,3E)-3-(cyclohexen-1-yl)-2-(ethoxymethyl)-5-methylhexa-1,3-dienyl]morpholine.
| Compound Name | 4-[(1E,3E)-3-(cyclohexen-1-yl)-2-(ethoxymethyl)-5-methylhexa-1,3-dienyl]morpholine |
|---|---|
| PubChem CID | 177476326 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 4-[(1E,3E)-3-(cyclohexen-1-yl)-2-(ethoxymethyl)-5-methylhexa-1,3-dienyl]morpholine |
| SMILES | CCOCC(=C/N1CCOCC1)/C(=C/C(C)C)C1=CCCCC1 |
| InChI | InChI=1S/C20H33NO2/c1-4-22-16-19(15-21-10-12-23-13-11-21)20(14-17(2)3)18-8-6-5-7-9-18/h8,14-15,17H,4-7,9-13,16H2,1-3H3/b19-15-,20-14+ |
| InChIKey | ZUDUAEKZFIMMPH-WSHWHQMZSA-N |
| XLogP | 4.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|