C32H62OSi4 — CID 177476384
[(E)-1-(1-adamantyl)-2-[4,5-dimethyl-1,1-bis(trimethylsilyl)-3,6-dihydro-2H-silin-2-yl]-3,3-dimethylbut-1-enoxy]-trimethylsilane (PubChem CID 177476384) has the molecular formula C32H62OSi4 and a molecular weight of 575.19 g/mol. Its IUPAC name is [(E)-1-(1-adamantyl)-2-[4,5-dimethyl-1,1-bis(trimethylsilyl)-3,6-dihydro-2H-silin-2-yl]-3,3-dimethylbut-1-enoxy]-trimethylsilane.
| Compound Name | [(E)-1-(1-adamantyl)-2-[4,5-dimethyl-1,1-bis(trimethylsilyl)-3,6-dihydro-2H-silin-2-yl]-3,3-dimethylbut-1-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 177476384 |
| Molecular Formula | C32H62OSi4 |
| Molecular Weight | 575.19 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | [(E)-1-(1-adamantyl)-2-[4,5-dimethyl-1,1-bis(trimethylsilyl)-3,6-dihydro-2H-silin-2-yl]-3,3-dimethylbut-1-enoxy]-trimethylsilane |
| SMILES | CC1=C(C)C[Si]([Si](C)(C)C)([Si](C)(C)C)C(/C(=C(/O[Si](C)(C)C)C23CC4CC(CC(C4)C2)C3)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H62OSi4/c1-23-15-28(37(22-24(23)2,35(9,10)11)36(12,13)14)29(31(3,4)5)30(33-34(6,7)8)32-19-25-16-26(20-32)18-27(17-25)21-32/h25-28H,15-22H2,1-14H3/b30-29- |
| InChIKey | UDYUBCXMLWMSBK-FLWNBWAVSA-N |
| XLogP | 10.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.19 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|